C23H34N4O5S — CID 39753944
N-[4-[2-(diethylamino)-5-(diethylsulfamoyl)anilino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 39753944) has the molecular formula C23H34N4O5S and a molecular weight of 478.62 g/mol. Its IUPAC name is N-[4-[2-(diethylamino)-5-(diethylsulfamoyl)anilino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[2-(diethylamino)-5-(diethylsulfamoyl)anilino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39753944 |
| Molecular Formula | C23H34N4O5S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-[4-[2-(diethylamino)-5-(diethylsulfamoyl)anilino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)CCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C23H34N4O5S/c1-5-26(6-2)20-14-13-18(33(30,31)27(7-3)8-4)17-19(20)25-22(28)12-9-15-24-23(29)21-11-10-16-32-21/h10-11,13-14,16-17H,5-9,12,15H2,1-4H3,(H,24,29)(H,25,28) |
| InChIKey | PCSYCXNVDMNACZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|