C23H34N4O4S2 — CID 43029748
N-[4-[2-(diethylamino)-5-(diethylsulfamoyl)anilino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 43029748) has the molecular formula C23H34N4O4S2 and a molecular weight of 494.68 g/mol. Its IUPAC name is N-[4-[2-(diethylamino)-5-(diethylsulfamoyl)anilino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[2-(diethylamino)-5-(diethylsulfamoyl)anilino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 43029748 |
| Molecular Formula | C23H34N4O4S2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | N-[4-[2-(diethylamino)-5-(diethylsulfamoyl)anilino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)CCCNC(=O)c1ccsc1 |
| InChI | InChI=1S/C23H34N4O4S2/c1-5-26(6-2)21-12-11-19(33(30,31)27(7-3)8-4)16-20(21)25-22(28)10-9-14-24-23(29)18-13-15-32-17-18/h11-13,15-17H,5-10,14H2,1-4H3,(H,24,29)(H,25,28) |
| InChIKey | IDAINNUOSNTXTL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|