C18H24N2O4S2 — CID 17470180
N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]thiophene-3-carboxamide (PubChem CID 17470180) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]thiophene-3-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 17470180 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]thiophene-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC(C)C)c(NC(=O)c2ccsc2)c1 |
| InChI | InChI=1S/C18H24N2O4S2/c1-5-20(6-2)26(22,23)15-7-8-17(24-13(3)4)16(11-15)19-18(21)14-9-10-25-12-14/h7-13H,5-6H2,1-4H3,(H,19,21) |
| InChIKey | CDVOTVKHCHOFFH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |