C19H23Cl2N3O4S — CID 26354825
3,6-dichloro-N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]pyridine-2-carboxamide (PubChem CID 26354825) has the molecular formula C19H23Cl2N3O4S and a molecular weight of 460.38 g/mol. Its IUPAC name is 3,6-dichloro-N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 26354825 |
| Molecular Formula | C19H23Cl2N3O4S |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 3,6-dichloro-N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]pyridine-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC(C)C)c(NC(=O)c2nc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C19H23Cl2N3O4S/c1-5-24(6-2)29(26,27)13-7-9-16(28-12(3)4)15(11-13)22-19(25)18-14(20)8-10-17(21)23-18/h7-12H,5-6H2,1-4H3,(H,22,25) |
| InChIKey | HCUSIKZICVQYDO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|