C21H27Cl2N3O4S — CID 24509414
2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]acetamide (PubChem CID 24509414) has the molecular formula C21H27Cl2N3O4S and a molecular weight of 488.44 g/mol. Its IUPAC name is 2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]acetamide.
| Compound Name | 2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]acetamide |
|---|---|
| PubChem CID | 24509414 |
| Molecular Formula | C21H27Cl2N3O4S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[5-(diethylsulfamoyl)-2-propan-2-yloxyphenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC(C)C)c(NC(=O)Cc2c(Cl)cc(C)nc2Cl)c1 |
| InChI | InChI=1S/C21H27Cl2N3O4S/c1-6-26(7-2)31(28,29)15-8-9-19(30-13(3)4)18(11-15)25-20(27)12-16-17(22)10-14(5)24-21(16)23/h8-11,13H,6-7,12H2,1-5H3,(H,25,27) |
| InChIKey | GSCXAZPFEDFQIV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|