C15H12Cl2F2N2O2 — CID 24509105
2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[2-(difluoromethoxy)phenyl]acetamide (PubChem CID 24509105) has the molecular formula C15H12Cl2F2N2O2 and a molecular weight of 361.18 g/mol. Its IUPAC name is 2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[2-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[2-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 24509105 |
| Molecular Formula | C15H12Cl2F2N2O2 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 2-(2,4-dichloro-6-methyl-3-pyridinyl)-N-[2-(difluoromethoxy)phenyl]acetamide |
| SMILES | Cc1cc(Cl)c(CC(=O)Nc2ccccc2OC(F)F)c(Cl)n1 |
| InChI | InChI=1S/C15H12Cl2F2N2O2/c1-8-6-10(16)9(14(17)20-8)7-13(22)21-11-4-2-3-5-12(11)23-15(18)19/h2-6,15H,7H2,1H3,(H,21,22) |
| InChIKey | IOOWQZURYBDOIV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|