C22H19Cl2N3O2 — CID 24509245
2-[[2-(2,4-dichloro-6-methyl-3-pyridinyl)acetyl]amino]-N-(3-methylphenyl)benzamide (PubChem CID 24509245) has the molecular formula C22H19Cl2N3O2 and a molecular weight of 428.32 g/mol. Its IUPAC name is 2-[[2-(2,4-dichloro-6-methyl-3-pyridinyl)acetyl]amino]-N-(3-methylphenyl)benzamide.
| Compound Name | 2-[[2-(2,4-dichloro-6-methyl-3-pyridinyl)acetyl]amino]-N-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 24509245 |
| Molecular Formula | C22H19Cl2N3O2 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 2-[[2-(2,4-dichloro-6-methyl-3-pyridinyl)acetyl]amino]-N-(3-methylphenyl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2NC(=O)Cc2c(Cl)cc(C)nc2Cl)c1 |
| InChI | InChI=1S/C22H19Cl2N3O2/c1-13-6-5-7-15(10-13)26-22(29)16-8-3-4-9-19(16)27-20(28)12-17-18(23)11-14(2)25-21(17)24/h3-11H,12H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | LXJYLLPWFQECCS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|