C15H16F2N2O2 — CID 82888104
2-(difluoromethoxy)-N-[(4-methoxy-6-methyl-2-pyridinyl)methyl]aniline (PubChem CID 82888104) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[(4-methoxy-6-methyl-2-pyridinyl)methyl]aniline.
| Compound Name | 2-(difluoromethoxy)-N-[(4-methoxy-6-methyl-2-pyridinyl)methyl]aniline |
|---|---|
| PubChem CID | 82888104 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-(difluoromethoxy)-N-[(4-methoxy-6-methyl-2-pyridinyl)methyl]aniline |
| SMILES | COc1cc(C)nc(CNc2ccccc2OC(F)F)c1 |
| InChI | InChI=1S/C15H16F2N2O2/c1-10-7-12(20-2)8-11(19-10)9-18-13-5-3-4-6-14(13)21-15(16)17/h3-8,15,18H,9H2,1-2H3 |
| InChIKey | QZAOATXITKXEIV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |