C17H21ClN2O3S2 — CID 55370603
N-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-thiophen-3-ylpropanamide (PubChem CID 55370603) has the molecular formula C17H21ClN2O3S2 and a molecular weight of 400.95 g/mol. Its IUPAC name is N-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-thiophen-3-ylpropanamide.
| Compound Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 55370603 |
| Molecular Formula | C17H21ClN2O3S2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-thiophen-3-ylpropanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(NC(=O)CCc2ccsc2)c1 |
| InChI | InChI=1S/C17H21ClN2O3S2/c1-3-20(4-2)25(22,23)14-6-7-15(18)16(11-14)19-17(21)8-5-13-9-10-24-12-13/h6-7,9-12H,3-5,8H2,1-2H3,(H,19,21) |
| InChIKey | JUYYKADOTKLNLL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |