C17H23NO2S2 — CID 101025089
N,N-diethyl-4-(3-thiophen-3-ylpropyl)benzenesulfonamide (PubChem CID 101025089) has the molecular formula C17H23NO2S2 and a molecular weight of 337.51 g/mol. Its IUPAC name is N,N-diethyl-4-(3-thiophen-3-ylpropyl)benzenesulfonamide.
| Compound Name | N,N-diethyl-4-(3-thiophen-3-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 101025089 |
| Molecular Formula | C17H23NO2S2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N,N-diethyl-4-(3-thiophen-3-ylpropyl)benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCCc2ccsc2)cc1 |
| InChI | InChI=1S/C17H23NO2S2/c1-3-18(4-2)22(19,20)17-10-8-15(9-11-17)6-5-7-16-12-13-21-14-16/h8-14H,3-7H2,1-2H3 |
| InChIKey | ZKKZAUAFJZQDDK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |