About 4-thiophen-3-ylbutanoate
4-thiophen-3-ylbutanoate (PubChem CID 86324435) has the molecular formula C8H9O2S-
and a molecular weight of 169.23 g/mol. Its IUPAC name is 4-thiophen-3-ylbutanoate.
Molecular Properties
| Compound Name | 4-thiophen-3-ylbutanoate |
| PubChem CID | 86324435 |
| Molecular Formula | C8H9O2S- |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 4-thiophen-3-ylbutanoate |
| SMILES | O=C([O-])CCCc1ccsc1 |
| InChI | InChI=1S/C8H10O2S/c9-8(10)3-1-2-7-4-5-11-6-7/h4-6H,1-3H2,(H,9,10)/p-1 |
| InChIKey | QICKSFILIHOSPO-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-thiophen-3-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiophen-3-ylbutanoate?
The IUPAC name of 4-thiophen-3-ylbutanoate (CID 86324435) is 4-thiophen-3-ylbutanoate.
What is the SMILES notation for 4-thiophen-3-ylbutanoate?
The canonical SMILES for 4-thiophen-3-ylbutanoate is O=C([O-])CCCc1ccsc1.
What is the InChIKey of 4-thiophen-3-ylbutanoate?
The InChIKey is QICKSFILIHOSPO-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10O2S/c9-8(10)3-1-2-7-4-5-11-6-7/h4-6H,1-3H2,(H,9,10)/p-1.
What are the key properties of 4-thiophen-3-ylbutanoate?
4-thiophen-3-ylbutanoate has a molecular weight of 169.23 g/mol, XLogP of 0.82, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiophen-3-ylbutanoate is sourced from PubChem (CID 86324435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).