About calcium bis(4-phenylbutanoate)
calcium bis(4-phenylbutanoate) (PubChem CID 11187721) has the molecular formula C20H22CaO4
and a molecular weight of 366.47 g/mol. Its IUPAC name is calcium bis(4-phenylbutanoate).
Molecular Properties
| Compound Name | calcium bis(4-phenylbutanoate) |
| PubChem CID | 11187721 |
| Molecular Formula | C20H22CaO4 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | calcium bis(4-phenylbutanoate) |
| SMILES | O=C([O-])CCCc1ccccc1.O=C([O-])CCCc1ccccc1.[Ca+2] |
| InChI | InChI=1S/2C10H12O2.Ca/c2*11-10(12)8-4-7-9-5-2-1-3-6-9;/h2*1-3,5-6H,4,7-8H2,(H,11,12);/q;;+2/p-2 |
| InChIKey | GPNVPGOWADQPIE-UHFFFAOYSA-L |
| XLogP | 1.14 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze calcium bis(4-phenylbutanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(4-phenylbutanoate)?
The IUPAC name of calcium bis(4-phenylbutanoate) (CID 11187721) is calcium bis(4-phenylbutanoate).
What is the SMILES notation for calcium bis(4-phenylbutanoate)?
The canonical SMILES for calcium bis(4-phenylbutanoate) is O=C([O-])CCCc1ccccc1.O=C([O-])CCCc1ccccc1.[Ca+2].
What is the InChIKey of calcium bis(4-phenylbutanoate)?
The InChIKey is GPNVPGOWADQPIE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H12O2.Ca/c2*11-10(12)8-4-7-9-5-2-1-3-6-9;/h2*1-3,5-6H,4,7-8H2,(H,11,12);/q;;+2/p-2.
What are the key properties of calcium bis(4-phenylbutanoate)?
calcium bis(4-phenylbutanoate) has a molecular weight of 366.47 g/mol, XLogP of 1.14, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(4-phenylbutanoate) is sourced from PubChem (CID 11187721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).