About 3-phenylpropylazanium acetate
3-phenylpropylazanium acetate (PubChem CID 67633985) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-phenylpropylazanium acetate.
Molecular Properties
| Compound Name | 3-phenylpropylazanium acetate |
| PubChem CID | 67633985 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-phenylpropylazanium acetate |
| SMILES | CC(=O)[O-].[NH3+]CCCc1ccccc1 |
| InChI | InChI=1S/C9H13N.C2H4O2/c10-8-4-7-9-5-2-1-3-6-9;1-2(3)4/h1-3,5-6H,4,7-8,10H2;1H3,(H,3,4) |
| InChIKey | OICAIIQHVNWNSS-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenylpropylazanium acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropylazanium acetate?
The IUPAC name of 3-phenylpropylazanium acetate (CID 67633985) is 3-phenylpropylazanium acetate.
What is the SMILES notation for 3-phenylpropylazanium acetate?
The canonical SMILES for 3-phenylpropylazanium acetate is CC(=O)[O-].[NH3+]CCCc1ccccc1.
What is the InChIKey of 3-phenylpropylazanium acetate?
The InChIKey is OICAIIQHVNWNSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C2H4O2/c10-8-4-7-9-5-2-1-3-6-9;1-2(3)4/h1-3,5-6H,4,7-8,10H2;1H3,(H,3,4).
What are the key properties of 3-phenylpropylazanium acetate?
3-phenylpropylazanium acetate has a molecular weight of 195.26 g/mol, XLogP of -0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropylazanium acetate is sourced from PubChem (CID 67633985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).