About phenylmethanediazonium acetate
phenylmethanediazonium acetate (PubChem CID 162310066) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is phenylmethanediazonium acetate.
Molecular Properties
| Compound Name | phenylmethanediazonium acetate |
| PubChem CID | 162310066 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | phenylmethanediazonium acetate |
| SMILES | CC(=O)[O-].N#[N+]Cc1ccccc1 |
| InChI | InChI=1S/C7H7N2.C2H4O2/c8-9-6-7-4-2-1-3-5-7;1-2(3)4/h1-5H,6H2;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | YTDYIVDHQYDSDN-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze phenylmethanediazonium acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanediazonium acetate?
The IUPAC name of phenylmethanediazonium acetate (CID 162310066) is phenylmethanediazonium acetate.
What is the SMILES notation for phenylmethanediazonium acetate?
The canonical SMILES for phenylmethanediazonium acetate is CC(=O)[O-].N#[N+]Cc1ccccc1.
What is the InChIKey of phenylmethanediazonium acetate?
The InChIKey is YTDYIVDHQYDSDN-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7N2.C2H4O2/c8-9-6-7-4-2-1-3-5-7;1-2(3)4/h1-5H,6H2;1H3,(H,3,4)/q+1;/p-1.
What are the key properties of phenylmethanediazonium acetate?
phenylmethanediazonium acetate has a molecular weight of 178.19 g/mol, XLogP of 0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanediazonium acetate is sourced from PubChem (CID 162310066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).