About amino(benzyl)azanium acetate
amino(benzyl)azanium acetate (PubChem CID 157138793) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is amino(benzyl)azanium acetate.
Molecular Properties
| Compound Name | amino(benzyl)azanium acetate |
| PubChem CID | 157138793 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | amino(benzyl)azanium acetate |
| SMILES | CC(=O)[O-].N[NH2+]Cc1ccccc1 |
| InChI | InChI=1S/C7H10N2.C2H4O2/c8-9-6-7-4-2-1-3-5-7;1-2(3)4/h1-5,9H,6,8H2;1H3,(H,3,4) |
| InChIKey | AJYFCRPNWYERRN-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino(benzyl)azanium acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino(benzyl)azanium acetate?
The IUPAC name of amino(benzyl)azanium acetate (CID 157138793) is amino(benzyl)azanium acetate.
What is the SMILES notation for amino(benzyl)azanium acetate?
The canonical SMILES for amino(benzyl)azanium acetate is CC(=O)[O-].N[NH2+]Cc1ccccc1.
What is the InChIKey of amino(benzyl)azanium acetate?
The InChIKey is AJYFCRPNWYERRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C2H4O2/c8-9-6-7-4-2-1-3-5-7;1-2(3)4/h1-5,9H,6,8H2;1H3,(H,3,4).
What are the key properties of amino(benzyl)azanium acetate?
amino(benzyl)azanium acetate has a molecular weight of 182.22 g/mol, XLogP of -1.62, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino(benzyl)azanium acetate is sourced from PubChem (CID 157138793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).