About gold(3+);triphenylphosphane;triacetate
gold(3+);triphenylphosphane;triacetate (PubChem CID 160881940) has the molecular formula C24H24AuO6P
and a molecular weight of 636.39 g/mol. Its IUPAC name is gold(3+);triphenylphosphane;triacetate.
Molecular Properties
| Compound Name | gold(3+);triphenylphosphane;triacetate |
| PubChem CID | 160881940 |
| Molecular Formula | C24H24AuO6P |
| Molecular Weight | 636.39 g/mol |
| Exact Mass | 636.10 |
| IUPAC Name | gold(3+);triphenylphosphane;triacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Au+3].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.3C2H4O2.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3*1-2(3)4;/h1-15H;3*1H3,(H,3,4);/q;;;;+3/p-3 |
| InChIKey | SNDNMEZHKSQUPJ-UHFFFAOYSA-K |
| XLogP | -0.29 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 636.39 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze gold(3+);triphenylphosphane;triacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(3+);triphenylphosphane;triacetate?
The IUPAC name of gold(3+);triphenylphosphane;triacetate (CID 160881940) is gold(3+);triphenylphosphane;triacetate.
What is the SMILES notation for gold(3+);triphenylphosphane;triacetate?
The canonical SMILES for gold(3+);triphenylphosphane;triacetate is CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Au+3].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of gold(3+);triphenylphosphane;triacetate?
The InChIKey is SNDNMEZHKSQUPJ-UHFFFAOYSA-K. The full InChI is InChI=1S/C18H15P.3C2H4O2.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3*1-2(3)4;/h1-15H;3*1H3,(H,3,4);/q;;;;+3/p-3.
What are the key properties of gold(3+);triphenylphosphane;triacetate?
gold(3+);triphenylphosphane;triacetate has a molecular weight of 636.39 g/mol, XLogP of -0.29, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for gold(3+);triphenylphosphane;triacetate is sourced from PubChem (CID 160881940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).