About 2-methylprop-2-enoic acid;triphenylphosphane
2-methylprop-2-enoic acid;triphenylphosphane (PubChem CID 173320900) has the molecular formula C22H21O2P
and a molecular weight of 348.38 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;triphenylphosphane.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;triphenylphosphane |
| PubChem CID | 173320900 |
| Molecular Formula | C22H21O2P |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-methylprop-2-enoic acid;triphenylphosphane |
| SMILES | C=C(C)C(=O)O.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C4H6O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3(2)4(5)6/h1-15H;1H2,2H3,(H,5,6) |
| InChIKey | IQJCKNAATAJOBN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;triphenylphosphane?
The IUPAC name of 2-methylprop-2-enoic acid;triphenylphosphane (CID 173320900) is 2-methylprop-2-enoic acid;triphenylphosphane.
What is the SMILES notation for 2-methylprop-2-enoic acid;triphenylphosphane?
The canonical SMILES for 2-methylprop-2-enoic acid;triphenylphosphane is C=C(C)C(=O)O.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-methylprop-2-enoic acid;triphenylphosphane?
The InChIKey is IQJCKNAATAJOBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C4H6O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3(2)4(5)6/h1-15H;1H2,2H3,(H,5,6).
What are the key properties of 2-methylprop-2-enoic acid;triphenylphosphane?
2-methylprop-2-enoic acid;triphenylphosphane has a molecular weight of 348.38 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;triphenylphosphane is sourced from PubChem (CID 173320900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).