C22H24NOP — CID 88649560
N,N-dimethylacetamide;triphenylphosphane (PubChem CID 88649560) has the molecular formula C22H24NOP and a molecular weight of 349.41 g/mol. Its IUPAC name is N,N-dimethylacetamide;triphenylphosphane.
| Compound Name | N,N-dimethylacetamide;triphenylphosphane |
|---|---|
| PubChem CID | 88649560 |
| Molecular Formula | C22H24NOP |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N,N-dimethylacetamide;triphenylphosphane |
| SMILES | CC(=O)N(C)C.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C4H9NO/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4(6)5(2)3/h1-15H;1-3H3 |
| InChIKey | BEPLTLAZPBOTEU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|