About propan-2-one;triphenylphosphane;hydrate
propan-2-one;triphenylphosphane;hydrate (PubChem CID 118484852) has the molecular formula C21H23O2P
and a molecular weight of 338.39 g/mol. Its IUPAC name is propan-2-one;triphenylphosphane;hydrate.
Molecular Properties
| Compound Name | propan-2-one;triphenylphosphane;hydrate |
| PubChem CID | 118484852 |
| Molecular Formula | C21H23O2P |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | propan-2-one;triphenylphosphane;hydrate |
| SMILES | CC(C)=O.O.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C3H6O.H2O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3(2)4;/h1-15H;1-2H3;1H2 |
| InChIKey | RHQOPZSANWHBIK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze propan-2-one;triphenylphosphane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-one;triphenylphosphane;hydrate?
The IUPAC name of propan-2-one;triphenylphosphane;hydrate (CID 118484852) is propan-2-one;triphenylphosphane;hydrate.
What is the SMILES notation for propan-2-one;triphenylphosphane;hydrate?
The canonical SMILES for propan-2-one;triphenylphosphane;hydrate is CC(C)=O.O.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of propan-2-one;triphenylphosphane;hydrate?
The InChIKey is RHQOPZSANWHBIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C3H6O.H2O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3(2)4;/h1-15H;1-2H3;1H2.
What are the key properties of propan-2-one;triphenylphosphane;hydrate?
propan-2-one;triphenylphosphane;hydrate has a molecular weight of 338.39 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-one;triphenylphosphane;hydrate is sourced from PubChem (CID 118484852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).