About palladium(2+);triphenylphosphane;diacetate
palladium(2+);triphenylphosphane;diacetate (PubChem CID 11554889) has the molecular formula C22H21O4PPd
and a molecular weight of 486.80 g/mol. Its IUPAC name is palladium(2+);triphenylphosphane;diacetate.
Molecular Properties
| Compound Name | palladium(2+);triphenylphosphane;diacetate |
| PubChem CID | 11554889 |
| Molecular Formula | C22H21O4PPd |
| Molecular Weight | 486.80 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | palladium(2+);triphenylphosphane;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Pd+2].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.2C2H4O2.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*1-2(3)4;/h1-15H;2*1H3,(H,3,4);/q;;;+2/p-2 |
| InChIKey | PEIYQTOXVAKKBN-UHFFFAOYSA-L |
| XLogP | 0.95 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.80 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze palladium(2+);triphenylphosphane;diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium(2+);triphenylphosphane;diacetate?
The IUPAC name of palladium(2+);triphenylphosphane;diacetate (CID 11554889) is palladium(2+);triphenylphosphane;diacetate.
What is the SMILES notation for palladium(2+);triphenylphosphane;diacetate?
The canonical SMILES for palladium(2+);triphenylphosphane;diacetate is CC(=O)[O-].CC(=O)[O-].[Pd+2].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of palladium(2+);triphenylphosphane;diacetate?
The InChIKey is PEIYQTOXVAKKBN-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H15P.2C2H4O2.Pd/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*1-2(3)4;/h1-15H;2*1H3,(H,3,4);/q;;;+2/p-2.
What are the key properties of palladium(2+);triphenylphosphane;diacetate?
palladium(2+);triphenylphosphane;diacetate has a molecular weight of 486.80 g/mol, XLogP of 0.95, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for palladium(2+);triphenylphosphane;diacetate is sourced from PubChem (CID 11554889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).