About methoxymethanone;triphenylphosphane;diacetate
methoxymethanone;triphenylphosphane;diacetate (PubChem CID 160722488) has the molecular formula C24H24O6P-3
and a molecular weight of 439.42 g/mol. Its IUPAC name is methoxymethanone;triphenylphosphane;diacetate.
Molecular Properties
| Compound Name | methoxymethanone;triphenylphosphane;diacetate |
| PubChem CID | 160722488 |
| Molecular Formula | C24H24O6P-3 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | methoxymethanone;triphenylphosphane;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].CO[C-]=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C2H3O2.2C2H4O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-2-3;2*1-2(3)4/h1-15H;1H3;2*1H3,(H,3,4)/q;-1;;/p-2 |
| InChIKey | DBSORHFVIGNJLV-UHFFFAOYSA-L |
| XLogP | 0.66 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methoxymethanone;triphenylphosphane;diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethanone;triphenylphosphane;diacetate?
The IUPAC name of methoxymethanone;triphenylphosphane;diacetate (CID 160722488) is methoxymethanone;triphenylphosphane;diacetate.
What is the SMILES notation for methoxymethanone;triphenylphosphane;diacetate?
The canonical SMILES for methoxymethanone;triphenylphosphane;diacetate is CC(=O)[O-].CC(=O)[O-].CO[C-]=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of methoxymethanone;triphenylphosphane;diacetate?
The InChIKey is DBSORHFVIGNJLV-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H15P.C2H3O2.2C2H4O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-2-3;2*1-2(3)4/h1-15H;1H3;2*1H3,(H,3,4)/q;-1;;/p-2.
What are the key properties of methoxymethanone;triphenylphosphane;diacetate?
methoxymethanone;triphenylphosphane;diacetate has a molecular weight of 439.42 g/mol, XLogP of 0.66, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethanone;triphenylphosphane;diacetate is sourced from PubChem (CID 160722488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).