About guanidine;methyl acetate;triphenylphosphane
guanidine;methyl acetate;triphenylphosphane (PubChem CID 174540505) has the molecular formula C22H26N3O2P
and a molecular weight of 395.44 g/mol. Its IUPAC name is guanidine;methyl acetate;triphenylphosphane.
Molecular Properties
| Compound Name | guanidine;methyl acetate;triphenylphosphane |
| PubChem CID | 174540505 |
| Molecular Formula | C22H26N3O2P |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | guanidine;methyl acetate;triphenylphosphane |
| SMILES | COC(C)=O.[H]N=C(N)N.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C3H6O2.CH5N3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3(4)5-2;2-1(3)4/h1-15H;1-2H3;(H5,2,3,4) |
| InChIKey | ANGJPPJRPKFWHN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze guanidine;methyl acetate;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of guanidine;methyl acetate;triphenylphosphane?
The IUPAC name of guanidine;methyl acetate;triphenylphosphane (CID 174540505) is guanidine;methyl acetate;triphenylphosphane.
What is the SMILES notation for guanidine;methyl acetate;triphenylphosphane?
The canonical SMILES for guanidine;methyl acetate;triphenylphosphane is COC(C)=O.[H]N=C(N)N.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of guanidine;methyl acetate;triphenylphosphane?
The InChIKey is ANGJPPJRPKFWHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C3H6O2.CH5N3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3(4)5-2;2-1(3)4/h1-15H;1-2H3;(H5,2,3,4).
What are the key properties of guanidine;methyl acetate;triphenylphosphane?
guanidine;methyl acetate;triphenylphosphane has a molecular weight of 395.44 g/mol, XLogP of 2.46, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for guanidine;methyl acetate;triphenylphosphane is sourced from PubChem (CID 174540505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).