About carbonyl dichloride;bis(triphenylphosphane)
carbonyl dichloride;bis(triphenylphosphane) (PubChem CID 87775041) has the molecular formula C37H30Cl2OP2
and a molecular weight of 623.50 g/mol. Its IUPAC name is carbonyl dichloride;bis(triphenylphosphane).
Molecular Properties
| Compound Name | carbonyl dichloride;bis(triphenylphosphane) |
| PubChem CID | 87775041 |
| Molecular Formula | C37H30Cl2OP2 |
| Molecular Weight | 623.50 g/mol |
| Exact Mass | 622.11 |
| IUPAC Name | carbonyl dichloride;bis(triphenylphosphane) |
| SMILES | O=C(Cl)Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H15P.CCl2O/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3)4/h2*1-15H; |
| InChIKey | BGZNWWAUPRXROO-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 623.50 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbonyl dichloride;bis(triphenylphosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonyl dichloride;bis(triphenylphosphane)?
The IUPAC name of carbonyl dichloride;bis(triphenylphosphane) (CID 87775041) is carbonyl dichloride;bis(triphenylphosphane).
What is the SMILES notation for carbonyl dichloride;bis(triphenylphosphane)?
The canonical SMILES for carbonyl dichloride;bis(triphenylphosphane) is O=C(Cl)Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of carbonyl dichloride;bis(triphenylphosphane)?
The InChIKey is BGZNWWAUPRXROO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H15P.CCl2O/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3)4/h2*1-15H;.
What are the key properties of carbonyl dichloride;bis(triphenylphosphane)?
carbonyl dichloride;bis(triphenylphosphane) has a molecular weight of 623.50 g/mol, XLogP of 8.47, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbonyl dichloride;bis(triphenylphosphane) is sourced from PubChem (CID 87775041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).