C22H17Cl6O4PRh — CID 173458936
rhodium;bis(2,2,2-trichloroacetic acid);triphenylphosphane (PubChem CID 173458936) has the molecular formula C22H17Cl6O4PRh and a molecular weight of 691.97 g/mol. Its IUPAC name is rhodium;bis(2,2,2-trichloroacetic acid);triphenylphosphane.
| Compound Name | rhodium;bis(2,2,2-trichloroacetic acid);triphenylphosphane |
|---|---|
| PubChem CID | 173458936 |
| Molecular Formula | C22H17Cl6O4PRh |
| Molecular Weight | 691.97 g/mol |
| Exact Mass | 688.81 |
| IUPAC Name | rhodium;bis(2,2,2-trichloroacetic acid);triphenylphosphane |
| SMILES | O=C(O)C(Cl)(Cl)Cl.O=C(O)C(Cl)(Cl)Cl.[Rh].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.2C2HCl3O2.Rh/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*3-2(4,5)1(6)7;/h1-15H;2*(H,6,7); |
| InChIKey | QPKXVJOLUCFBEB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.97 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|