C22H19F4O4PRh — CID 173458456
bis(2,2-difluoroacetic acid);rhodium;triphenylphosphane (PubChem CID 173458456) has the molecular formula C22H19F4O4PRh and a molecular weight of 557.26 g/mol. Its IUPAC name is bis(2,2-difluoroacetic acid);rhodium;triphenylphosphane.
| Compound Name | bis(2,2-difluoroacetic acid);rhodium;triphenylphosphane |
|---|---|
| PubChem CID | 173458456 |
| Molecular Formula | C22H19F4O4PRh |
| Molecular Weight | 557.26 g/mol |
| Exact Mass | 557.00 |
| IUPAC Name | bis(2,2-difluoroacetic acid);rhodium;triphenylphosphane |
| SMILES | O=C(O)C(F)F.O=C(O)C(F)F.[Rh].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.2C2H2F2O2.Rh/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*3-1(4)2(5)6;/h1-15H;2*1H,(H,5,6); |
| InChIKey | KXXYKBMAHLVCAA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|