C14H11F2OP — CID 23414438
1-diphenylphosphanyl-2,2-difluoroethanone (PubChem CID 23414438) has the molecular formula C14H11F2OP and a molecular weight of 264.21 g/mol. Its IUPAC name is 1-diphenylphosphanyl-2,2-difluoroethanone.
| Compound Name | 1-diphenylphosphanyl-2,2-difluoroethanone |
|---|---|
| PubChem CID | 23414438 |
| Molecular Formula | C14H11F2OP |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 1-diphenylphosphanyl-2,2-difluoroethanone |
| SMILES | O=C(C(F)F)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H11F2OP/c15-13(16)14(17)18(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | PIJVOWDGCDBPHZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|