C17H21O2P2+ — CID 158642477
1-diphenylphosphanyl-2,2-dimethylpropan-1-one;oxophosphanium (PubChem CID 158642477) has the molecular formula C17H21O2P2+ and a molecular weight of 319.30 g/mol. Its IUPAC name is 1-diphenylphosphanyl-2,2-dimethylpropan-1-one;oxophosphanium.
| Compound Name | 1-diphenylphosphanyl-2,2-dimethylpropan-1-one;oxophosphanium |
|---|---|
| PubChem CID | 158642477 |
| Molecular Formula | C17H21O2P2+ |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 1-diphenylphosphanyl-2,2-dimethylpropan-1-one;oxophosphanium |
| SMILES | CC(C)(C)C(=O)P(c1ccccc1)c1ccccc1.O=[PH2+] |
| InChI | InChI=1S/C17H19OP.H2OP/c1-17(2,3)16(18)19(14-10-6-4-7-11-14)15-12-8-5-9-13-15;1-2/h4-13H,1-3H3;2H2/q;+1 |
| InChIKey | FTSGVHXCKDKTOP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|