C31H30O2P2 — CID 13144223
1,7-bis(diphenylphosphanyl)heptane-1,7-dione (PubChem CID 13144223) has the molecular formula C31H30O2P2 and a molecular weight of 496.53 g/mol. Its IUPAC name is 1,7-bis(diphenylphosphanyl)heptane-1,7-dione.
| Compound Name | 1,7-bis(diphenylphosphanyl)heptane-1,7-dione |
|---|---|
| PubChem CID | 13144223 |
| Molecular Formula | C31H30O2P2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 1,7-bis(diphenylphosphanyl)heptane-1,7-dione |
| SMILES | O=C(CCCCCC(=O)P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30O2P2/c32-30(34(26-16-6-1-7-17-26)27-18-8-2-9-19-27)24-14-5-15-25-31(33)35(28-20-10-3-11-21-28)29-22-12-4-13-23-29/h1-4,6-13,16-23H,5,14-15,24-25H2 |
| InChIKey | BSISSDMWOGGTEF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|