C37H42OP2S — CID 102075255
S-[(Z)-10,11-bis(diphenylphosphanyl)undec-10-enyl] ethanethioate (PubChem CID 102075255) has the molecular formula C37H42OP2S and a molecular weight of 596.76 g/mol. Its IUPAC name is S-[(Z)-10,11-bis(diphenylphosphanyl)undec-10-enyl] ethanethioate.
| Compound Name | S-[(Z)-10,11-bis(diphenylphosphanyl)undec-10-enyl] ethanethioate |
|---|---|
| PubChem CID | 102075255 |
| Molecular Formula | C37H42OP2S |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | S-[(Z)-10,11-bis(diphenylphosphanyl)undec-10-enyl] ethanethioate |
| SMILES | CC(=O)SCCCCCCCCC/C(=C/P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H42OP2S/c1-32(38)41-30-20-6-4-2-3-5-11-29-37(40(35-25-16-9-17-26-35)36-27-18-10-19-28-36)31-39(33-21-12-7-13-22-33)34-23-14-8-15-24-34/h7-10,12-19,21-28,31H,2-6,11,20,29-30H2,1H3/b37-31- |
| InChIKey | CBTSUWDQPWRKAD-OXKNFPIISA-N |
| XLogP | 9.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|