C39H64O8S6 — CID 167600523
S-[15-acetylsulfanyl-4,4,12,12-tetrakis(3-acetylsulfanylpropyl)-5,11-dioxopentadecyl] ethanethioate (PubChem CID 167600523) has the molecular formula C39H64O8S6 and a molecular weight of 853.33 g/mol. Its IUPAC name is S-[15-acetylsulfanyl-4,4,12,12-tetrakis(3-acetylsulfanylpropyl)-5,11-dioxopentadecyl] ethanethioate.
| Compound Name | S-[15-acetylsulfanyl-4,4,12,12-tetrakis(3-acetylsulfanylpropyl)-5,11-dioxopentadecyl] ethanethioate |
|---|---|
| PubChem CID | 167600523 |
| Molecular Formula | C39H64O8S6 |
| Molecular Weight | 853.33 g/mol |
| Exact Mass | 852.29 |
| IUPAC Name | S-[15-acetylsulfanyl-4,4,12,12-tetrakis(3-acetylsulfanylpropyl)-5,11-dioxopentadecyl] ethanethioate |
| SMILES | CC(=O)SCCCC(CCCSC(C)=O)(CCCSC(C)=O)C(=O)CCCCCC(=O)C(CCCSC(C)=O)(CCCSC(C)=O)CCCSC(C)=O |
| InChI | InChI=1S/C39H64O8S6/c1-30(40)48-24-10-18-38(19-11-25-49-31(2)41,20-12-26-50-32(3)42)36(46)16-8-7-9-17-37(47)39(21-13-27-51-33(4)43,22-14-28-52-34(5)44)23-15-29-53-35(6)45/h7-29H2,1-6H3 |
| InChIKey | CTVPGKZOHPWLSJ-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.33 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|