C15H30O3S2 — CID 102034172
S-[10,10-bis(hydroxymethyl)-11-sulfanylundecyl] ethanethioate (PubChem CID 102034172) has the molecular formula C15H30O3S2 and a molecular weight of 322.54 g/mol. Its IUPAC name is S-[10,10-bis(hydroxymethyl)-11-sulfanylundecyl] ethanethioate.
| Compound Name | S-[10,10-bis(hydroxymethyl)-11-sulfanylundecyl] ethanethioate |
|---|---|
| PubChem CID | 102034172 |
| Molecular Formula | C15H30O3S2 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | S-[10,10-bis(hydroxymethyl)-11-sulfanylundecyl] ethanethioate |
| SMILES | CC(=O)SCCCCCCCCCC(CO)(CO)CS |
| InChI | InChI=1S/C15H30O3S2/c1-14(18)20-10-8-6-4-2-3-5-7-9-15(11-16,12-17)13-19/h16-17,19H,2-13H2,1H3 |
| InChIKey | XZOXGGMTCQPPAX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|