About S-non-5-ynyl ethanethioate
S-non-5-ynyl ethanethioate (PubChem CID 10375487) has the molecular formula C11H18OS
and a molecular weight of 198.33 g/mol. Its IUPAC name is S-non-5-ynyl ethanethioate.
Molecular Properties
| Compound Name | S-non-5-ynyl ethanethioate |
| PubChem CID | 10375487 |
| Molecular Formula | C11H18OS |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | S-non-5-ynyl ethanethioate |
| SMILES | CCCC#CCCCCSC(C)=O |
| InChI | InChI=1S/C11H18OS/c1-3-4-5-6-7-8-9-10-13-11(2)12/h3-4,7-10H2,1-2H3 |
| InChIKey | ORNPSXYURJGQDP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze S-non-5-ynyl ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-non-5-ynyl ethanethioate?
The IUPAC name of S-non-5-ynyl ethanethioate (CID 10375487) is S-non-5-ynyl ethanethioate.
What is the SMILES notation for S-non-5-ynyl ethanethioate?
The canonical SMILES for S-non-5-ynyl ethanethioate is CCCC#CCCCCSC(C)=O.
What is the InChIKey of S-non-5-ynyl ethanethioate?
The InChIKey is ORNPSXYURJGQDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18OS/c1-3-4-5-6-7-8-9-10-13-11(2)12/h3-4,7-10H2,1-2H3.
What are the key properties of S-non-5-ynyl ethanethioate?
S-non-5-ynyl ethanethioate has a molecular weight of 198.33 g/mol, XLogP of 3.24, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-non-5-ynyl ethanethioate is sourced from PubChem (CID 10375487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).