tridec-9-ynoic acid

C13H22O2 — CID 5312723

IUPACtridec-9-ynoic acid
SMILESCCCC#CCCCCCCCC(=O)O
InChIInChI=1S/C13H22O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-3,6-12H2,1H3,(H,14,15)
InChIKeyIRTOCVRQBHTLDD-UHFFFAOYSA-N
MW210.32 g/mol
LogP3.61
Rot. Bonds8

About tridec-9-ynoic acid

tridec-9-ynoic acid (PubChem CID 5312723) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is tridec-9-ynoic acid.

Molecular Properties

Compound Nametridec-9-ynoic acid
PubChem CID5312723
Molecular FormulaC13H22O2
Molecular Weight210.32 g/mol
Exact Mass210.16
IUPAC Nametridec-9-ynoic acid
SMILESCCCC#CCCCCCCCC(=O)O
InChIInChI=1S/C13H22O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-3,6-12H2,1H3,(H,14,15)
InChIKeyIRTOCVRQBHTLDD-UHFFFAOYSA-N
XLogP3.61
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds8
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.32
LogP ≤ 53.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze tridec-9-ynoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tridec-9-ynoic acid?
The IUPAC name of tridec-9-ynoic acid (CID 5312723) is tridec-9-ynoic acid.
What is the SMILES notation for tridec-9-ynoic acid?
The canonical SMILES for tridec-9-ynoic acid is CCCC#CCCCCCCCC(=O)O.
What is the InChIKey of tridec-9-ynoic acid?
The InChIKey is IRTOCVRQBHTLDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-3,6-12H2,1H3,(H,14,15).
What are the key properties of tridec-9-ynoic acid?
tridec-9-ynoic acid has a molecular weight of 210.32 g/mol, XLogP of 3.61, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tridec-9-ynoic acid is sourced from PubChem (CID 5312723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).