About 11-hydroxyundec-7-ynoic acid
11-hydroxyundec-7-ynoic acid (PubChem CID 44576578) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is 11-hydroxyundec-7-ynoic acid.
Molecular Properties
| Compound Name | 11-hydroxyundec-7-ynoic acid |
| PubChem CID | 44576578 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 11-hydroxyundec-7-ynoic acid |
| SMILES | O=C(O)CCCCCC#CCCCO |
| InChI | InChI=1S/C11H18O3/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h12H,1,3,5-10H2,(H,13,14) |
| InChIKey | QRRCXSBNDNFJRV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 11-hydroxyundec-7-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-hydroxyundec-7-ynoic acid?
The IUPAC name of 11-hydroxyundec-7-ynoic acid (CID 44576578) is 11-hydroxyundec-7-ynoic acid.
What is the SMILES notation for 11-hydroxyundec-7-ynoic acid?
The canonical SMILES for 11-hydroxyundec-7-ynoic acid is O=C(O)CCCCCC#CCCCO.
What is the InChIKey of 11-hydroxyundec-7-ynoic acid?
The InChIKey is QRRCXSBNDNFJRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h12H,1,3,5-10H2,(H,13,14).
What are the key properties of 11-hydroxyundec-7-ynoic acid?
11-hydroxyundec-7-ynoic acid has a molecular weight of 198.26 g/mol, XLogP of 1.80, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-hydroxyundec-7-ynoic acid is sourced from PubChem (CID 44576578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).