10-hydroxydecanoic acid

C20H40O6 — CID 138734563

IUPAC10-hydroxydecanoic acid
SMILESO=C(O)CCCCCCCCCO.O=C(O)CCCCCCCCCO
InChIInChI=1S/2C10H20O3/c2*11-9-7-5-3-1-2-4-6-8-10(12)13/h2*11H,1-9H2,(H,12,13)
InChIKeyNZWNAEATRUECSK-UHFFFAOYSA-N
MW376.53 g/mol
LogP4.37
Rot. Bonds18

About 10-hydroxydecanoic acid

10-hydroxydecanoic acid (PubChem CID 138734563) has the molecular formula C20H40O6 and a molecular weight of 376.53 g/mol. Its IUPAC name is 10-hydroxydecanoic acid.

Molecular Properties

Compound Name10-hydroxydecanoic acid
PubChem CID138734563
Molecular FormulaC20H40O6
Molecular Weight376.53 g/mol
Exact Mass376.28
IUPAC Name10-hydroxydecanoic acid
SMILESO=C(O)CCCCCCCCCO.O=C(O)CCCCCCCCCO
InChIInChI=1S/2C10H20O3/c2*11-9-7-5-3-1-2-4-6-8-10(12)13/h2*11H,1-9H2,(H,12,13)
InChIKeyNZWNAEATRUECSK-UHFFFAOYSA-N
XLogP4.37
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds18
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500376.53
LogP ≤ 54.37
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 10-hydroxydecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 10-hydroxydecanoic acid?
The IUPAC name of 10-hydroxydecanoic acid (CID 138734563) is 10-hydroxydecanoic acid.
What is the SMILES notation for 10-hydroxydecanoic acid?
The canonical SMILES for 10-hydroxydecanoic acid is O=C(O)CCCCCCCCCO.O=C(O)CCCCCCCCCO.
What is the InChIKey of 10-hydroxydecanoic acid?
The InChIKey is NZWNAEATRUECSK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H20O3/c2*11-9-7-5-3-1-2-4-6-8-10(12)13/h2*11H,1-9H2,(H,12,13).
What are the key properties of 10-hydroxydecanoic acid?
10-hydroxydecanoic acid has a molecular weight of 376.53 g/mol, XLogP of 4.37, 18 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-hydroxydecanoic acid is sourced from PubChem (CID 138734563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).