About 12-hydroxydodecanoic acid;zinc
12-hydroxydodecanoic acid;zinc (PubChem CID 88673734) has the molecular formula C12H24O3Zn
and a molecular weight of 281.71 g/mol. Its IUPAC name is 12-hydroxydodecanoic acid;zinc.
Molecular Properties
| Compound Name | 12-hydroxydodecanoic acid;zinc |
| PubChem CID | 88673734 |
| Molecular Formula | C12H24O3Zn |
| Molecular Weight | 281.71 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 12-hydroxydodecanoic acid;zinc |
| SMILES | O=C(O)CCCCCCCCCCCO.[Zn] |
| InChI | InChI=1S/C12H24O3.Zn/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15;/h13H,1-11H2,(H,14,15); |
| InChIKey | HMAQUUVVGPKWEX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.71 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 12-hydroxydodecanoic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-hydroxydodecanoic acid;zinc?
The IUPAC name of 12-hydroxydodecanoic acid;zinc (CID 88673734) is 12-hydroxydodecanoic acid;zinc.
What is the SMILES notation for 12-hydroxydodecanoic acid;zinc?
The canonical SMILES for 12-hydroxydodecanoic acid;zinc is O=C(O)CCCCCCCCCCCO.[Zn].
What is the InChIKey of 12-hydroxydodecanoic acid;zinc?
The InChIKey is HMAQUUVVGPKWEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3.Zn/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15;/h13H,1-11H2,(H,14,15);.
What are the key properties of 12-hydroxydodecanoic acid;zinc?
12-hydroxydodecanoic acid;zinc has a molecular weight of 281.71 g/mol, XLogP of 2.96, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-hydroxydodecanoic acid;zinc is sourced from PubChem (CID 88673734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).