About lithium;hydride;5-hydroxypentanoic acid
lithium;hydride;5-hydroxypentanoic acid (PubChem CID 173343870) has the molecular formula C5H11LiO3
and a molecular weight of 126.08 g/mol. Its IUPAC name is lithium;hydride;5-hydroxypentanoic acid.
Molecular Properties
| Compound Name | lithium;hydride;5-hydroxypentanoic acid |
| PubChem CID | 173343870 |
| Molecular Formula | C5H11LiO3 |
| Molecular Weight | 126.08 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | lithium;hydride;5-hydroxypentanoic acid |
| SMILES | O=C(O)CCCCO.[H-].[Li+] |
| InChI | InChI=1S/C5H10O3.Li.H/c6-4-2-1-3-5(7)8;;/h6H,1-4H2,(H,7,8);;/q;+1;-1 |
| InChIKey | JXXGIQGDGUHGKB-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.08 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;5-hydroxypentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;5-hydroxypentanoic acid?
The IUPAC name of lithium;hydride;5-hydroxypentanoic acid (CID 173343870) is lithium;hydride;5-hydroxypentanoic acid.
What is the SMILES notation for lithium;hydride;5-hydroxypentanoic acid?
The canonical SMILES for lithium;hydride;5-hydroxypentanoic acid is O=C(O)CCCCO.[H-].[Li+].
What is the InChIKey of lithium;hydride;5-hydroxypentanoic acid?
The InChIKey is JXXGIQGDGUHGKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.Li.H/c6-4-2-1-3-5(7)8;;/h6H,1-4H2,(H,7,8);;/q;+1;-1.
What are the key properties of lithium;hydride;5-hydroxypentanoic acid?
lithium;hydride;5-hydroxypentanoic acid has a molecular weight of 126.08 g/mol, XLogP of -2.65, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;5-hydroxypentanoic acid is sourced from PubChem (CID 173343870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).