C22H36O2 — CID 87546312
docosa-7,15-diynoic acid (PubChem CID 87546312) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is docosa-7,15-diynoic acid.
| Compound Name | docosa-7,15-diynoic acid |
|---|---|
| PubChem CID | 87546312 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | docosa-7,15-diynoic acid |
| SMILES | CCCCCCC#CCCCCCCC#CCCCCCC(=O)O |
| InChI | InChI=1S/C22H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h2-6,9-14,17-21H2,1H3,(H,23,24) |
| InChIKey | HFVJPDXDPDSUSA-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|