docosa-7,15-diynoic acid

C22H36O2 — CID 87546312

IUPACdocosa-7,15-diynoic acid
SMILESCCCCCCC#CCCCCCCC#CCCCCCC(=O)O
InChIInChI=1S/C22H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h2-6,9-14,17-21H2,1H3,(H,23,24)
InChIKeyHFVJPDXDPDSUSA-UHFFFAOYSA-N
MW332.53 g/mol
LogP6.34
Rot. Bonds14

About docosa-7,15-diynoic acid

docosa-7,15-diynoic acid (PubChem CID 87546312) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is docosa-7,15-diynoic acid.

Molecular Properties

Compound Namedocosa-7,15-diynoic acid
PubChem CID87546312
Molecular FormulaC22H36O2
Molecular Weight332.53 g/mol
Exact Mass332.27
IUPAC Namedocosa-7,15-diynoic acid
SMILESCCCCCCC#CCCCCCCC#CCCCCCC(=O)O
InChIInChI=1S/C22H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h2-6,9-14,17-21H2,1H3,(H,23,24)
InChIKeyHFVJPDXDPDSUSA-UHFFFAOYSA-N
XLogP6.34
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds14
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500332.53
LogP ≤ 56.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze docosa-7,15-diynoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of docosa-7,15-diynoic acid?
The IUPAC name of docosa-7,15-diynoic acid (CID 87546312) is docosa-7,15-diynoic acid.
What is the SMILES notation for docosa-7,15-diynoic acid?
The canonical SMILES for docosa-7,15-diynoic acid is CCCCCCC#CCCCCCCC#CCCCCCC(=O)O.
What is the InChIKey of docosa-7,15-diynoic acid?
The InChIKey is HFVJPDXDPDSUSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h2-6,9-14,17-21H2,1H3,(H,23,24).
What are the key properties of docosa-7,15-diynoic acid?
docosa-7,15-diynoic acid has a molecular weight of 332.53 g/mol, XLogP of 6.34, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for docosa-7,15-diynoic acid is sourced from PubChem (CID 87546312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).