About hexadec-5-ynoic acid
hexadec-5-ynoic acid (PubChem CID 15958429) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is hexadec-5-ynoic acid.
Molecular Properties
| Compound Name | hexadec-5-ynoic acid |
| PubChem CID | 15958429 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | hexadec-5-ynoic acid |
| SMILES | CCCCCCCCCCC#CCCCC(=O)O |
| InChI | InChI=1S/C16H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-10,13-15H2,1H3,(H,17,18) |
| InChIKey | XDPHRZGPXHHHCG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze hexadec-5-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadec-5-ynoic acid?
The IUPAC name of hexadec-5-ynoic acid (CID 15958429) is hexadec-5-ynoic acid.
What is the SMILES notation for hexadec-5-ynoic acid?
The canonical SMILES for hexadec-5-ynoic acid is CCCCCCCCCCC#CCCCC(=O)O.
What is the InChIKey of hexadec-5-ynoic acid?
The InChIKey is XDPHRZGPXHHHCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-10,13-15H2,1H3,(H,17,18).
What are the key properties of hexadec-5-ynoic acid?
hexadec-5-ynoic acid has a molecular weight of 252.40 g/mol, XLogP of 4.78, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexadec-5-ynoic acid is sourced from PubChem (CID 15958429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).