C18H28O2 — CID 1931
octadeca-9,12-diynoic acid (PubChem CID 1931) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is octadeca-9,12-diynoic acid.
| Compound Name | octadeca-9,12-diynoic acid |
|---|---|
| PubChem CID | 1931 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | octadeca-9,12-diynoic acid |
| SMILES | CCCCCC#CCC#CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-5,8,11-17H2,1H3,(H,19,20) |
| InChIKey | KDYILQLPKVZDGB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|