C19H30O2 — CID 89160943
nonadeca-10,12-diynoic acid (PubChem CID 89160943) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is nonadeca-10,12-diynoic acid.
| Compound Name | nonadeca-10,12-diynoic acid |
|---|---|
| PubChem CID | 89160943 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | nonadeca-10,12-diynoic acid |
| SMILES | CCCCCCC#CC#CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h2-6,11-18H2,1H3,(H,20,21) |
| InChIKey | GDMLRJSMDATKEO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|