octadeca-4,8-diynoic acid

C18H28O2 — CID 5312650

IUPACoctadeca-4,8-diynoic acid
SMILESCCCCCCCCCC#CCCC#CCCC(=O)O
InChIInChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-9,12-13,16-17H2,1H3,(H,19,20)
InChIKeyYZDIRPUOQIVUSQ-UHFFFAOYSA-N
MW276.42 g/mol
LogP4.78
Rot. Bonds10

About octadeca-4,8-diynoic acid

octadeca-4,8-diynoic acid (PubChem CID 5312650) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is octadeca-4,8-diynoic acid.

Molecular Properties

Compound Nameoctadeca-4,8-diynoic acid
PubChem CID5312650
Molecular FormulaC18H28O2
Molecular Weight276.42 g/mol
Exact Mass276.21
IUPAC Nameoctadeca-4,8-diynoic acid
SMILESCCCCCCCCCC#CCCC#CCCC(=O)O
InChIInChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-9,12-13,16-17H2,1H3,(H,19,20)
InChIKeyYZDIRPUOQIVUSQ-UHFFFAOYSA-N
XLogP4.78
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds10
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.42
LogP ≤ 54.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze octadeca-4,8-diynoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of octadeca-4,8-diynoic acid?
The IUPAC name of octadeca-4,8-diynoic acid (CID 5312650) is octadeca-4,8-diynoic acid.
What is the SMILES notation for octadeca-4,8-diynoic acid?
The canonical SMILES for octadeca-4,8-diynoic acid is CCCCCCCCCC#CCCC#CCCC(=O)O.
What is the InChIKey of octadeca-4,8-diynoic acid?
The InChIKey is YZDIRPUOQIVUSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-9,12-13,16-17H2,1H3,(H,19,20).
What are the key properties of octadeca-4,8-diynoic acid?
octadeca-4,8-diynoic acid has a molecular weight of 276.42 g/mol, XLogP of 4.78, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octadeca-4,8-diynoic acid is sourced from PubChem (CID 5312650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).