C37H64O6S6 — CID 167600522
S-[13-acetylsulfanyl-4,4,10,10-tetrakis(3-acetylsulfanylpropyl)tridecyl] ethanethioate (PubChem CID 167600522) has the molecular formula C37H64O6S6 and a molecular weight of 797.31 g/mol. Its IUPAC name is S-[13-acetylsulfanyl-4,4,10,10-tetrakis(3-acetylsulfanylpropyl)tridecyl] ethanethioate.
| Compound Name | S-[13-acetylsulfanyl-4,4,10,10-tetrakis(3-acetylsulfanylpropyl)tridecyl] ethanethioate |
|---|---|
| PubChem CID | 167600522 |
| Molecular Formula | C37H64O6S6 |
| Molecular Weight | 797.31 g/mol |
| Exact Mass | 796.30 |
| IUPAC Name | S-[13-acetylsulfanyl-4,4,10,10-tetrakis(3-acetylsulfanylpropyl)tridecyl] ethanethioate |
| SMILES | CC(=O)SCCCC(CCCCCC(CCCSC(C)=O)(CCCSC(C)=O)CCCSC(C)=O)(CCCSC(C)=O)CCCSC(C)=O |
| InChI | InChI=1S/C37H64O6S6/c1-30(38)44-24-10-18-36(19-11-25-45-31(2)39,20-12-26-46-32(3)40)16-8-7-9-17-37(21-13-27-47-33(4)41,22-14-28-48-34(5)42)23-15-29-49-35(6)43/h7-29H2,1-6H3 |
| InChIKey | DAYANMJQFQFWGR-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.31 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|