C12H22O4S2 — CID 59345691
S-[3-[2-(3-acetylsulfanylpropoxy)ethoxy]propyl] ethanethioate (PubChem CID 59345691) has the molecular formula C12H22O4S2 and a molecular weight of 294.44 g/mol. Its IUPAC name is S-[3-[2-(3-acetylsulfanylpropoxy)ethoxy]propyl] ethanethioate.
| Compound Name | S-[3-[2-(3-acetylsulfanylpropoxy)ethoxy]propyl] ethanethioate |
|---|---|
| PubChem CID | 59345691 |
| Molecular Formula | C12H22O4S2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | S-[3-[2-(3-acetylsulfanylpropoxy)ethoxy]propyl] ethanethioate |
| SMILES | CC(=O)SCCCOCCOCCCSC(C)=O |
| InChI | InChI=1S/C12H22O4S2/c1-11(13)17-9-3-5-15-7-8-16-6-4-10-18-12(2)14/h3-10H2,1-2H3 |
| InChIKey | ARYWMGGAACWIEO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|