C8H16O3S — CID 10607788
S-[2-(2-ethoxyethoxy)ethyl] ethanethioate (PubChem CID 10607788) has the molecular formula C8H16O3S and a molecular weight of 192.28 g/mol. Its IUPAC name is S-[2-(2-ethoxyethoxy)ethyl] ethanethioate.
| Compound Name | S-[2-(2-ethoxyethoxy)ethyl] ethanethioate |
|---|---|
| PubChem CID | 10607788 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | S-[2-(2-ethoxyethoxy)ethyl] ethanethioate |
| SMILES | CCOCCOCCSC(C)=O |
| InChI | InChI=1S/C8H16O3S/c1-3-10-4-5-11-6-7-12-8(2)9/h3-7H2,1-2H3 |
| InChIKey | ASAZHWTWKWSCBX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|