C12H22O5S — CID 167520638
tert-butyl 2-[2-(2-acetylsulfanylethoxy)ethoxy]acetate (PubChem CID 167520638) has the molecular formula C12H22O5S and a molecular weight of 278.37 g/mol. Its IUPAC name is tert-butyl 2-[2-(2-acetylsulfanylethoxy)ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-(2-acetylsulfanylethoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 167520638 |
| Molecular Formula | C12H22O5S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | tert-butyl 2-[2-(2-acetylsulfanylethoxy)ethoxy]acetate |
| SMILES | CC(=O)SCCOCCOCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22O5S/c1-10(13)18-8-7-15-5-6-16-9-11(14)17-12(2,3)4/h5-9H2,1-4H3 |
| InChIKey | YUFCIXJFHRTZKV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|