C14H28O4 — CID 176640180
tert-butyl 2-[2-(3,3-dimethylbutoxy)ethoxy]acetate (PubChem CID 176640180) has the molecular formula C14H28O4 and a molecular weight of 260.37 g/mol. Its IUPAC name is tert-butyl 2-[2-(3,3-dimethylbutoxy)ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-(3,3-dimethylbutoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 176640180 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | tert-butyl 2-[2-(3,3-dimethylbutoxy)ethoxy]acetate |
| SMILES | CC(C)(C)CCOCCOCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28O4/c1-13(2,3)7-8-16-9-10-17-11-12(15)18-14(4,5)6/h7-11H2,1-6H3 |
| InChIKey | OKAFQCVZYDEAQH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|