C18H37NO7 — CID 126602178
tert-butyl 2-[2-[2-[3-[2-[2-(methylamino)ethoxy]ethoxy]propoxy]ethoxy]ethoxy]acetate (PubChem CID 126602178) has the molecular formula C18H37NO7 and a molecular weight of 379.49 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[3-[2-[2-(methylamino)ethoxy]ethoxy]propoxy]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[3-[2-[2-(methylamino)ethoxy]ethoxy]propoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 126602178 |
| Molecular Formula | C18H37NO7 |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | tert-butyl 2-[2-[2-[3-[2-[2-(methylamino)ethoxy]ethoxy]propoxy]ethoxy]ethoxy]acetate |
| SMILES | CNCCOCCOCCCOCCOCCOCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H37NO7/c1-18(2,3)26-17(20)16-25-15-14-24-13-11-22-8-5-7-21-10-12-23-9-6-19-4/h19H,5-16H2,1-4H3 |
| InChIKey | KLNQVNPEVHWVCF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|