About tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate
tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate (PubChem CID 162115968) has the molecular formula C20H42N2O7
and a molecular weight of 422.56 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate.
Molecular Properties
| Compound Name | tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate |
| PubChem CID | 162115968 |
| Molecular Formula | C20H42N2O7 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate |
| SMILES | CNCCCC(=O)OC.CNCCOCCOCCOCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H29NO5.C6H13NO2/c1-14(2,3)20-13(16)5-7-17-9-11-19-12-10-18-8-6-15-4;1-7-5-3-4-6(8)9-2/h15H,5-12H2,1-4H3;7H,3-5H2,1-2H3 |
| InChIKey | ZGTOOVWMIVEGJR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate?
The IUPAC name of tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate (CID 162115968) is tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate.
What is the SMILES notation for tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate?
The canonical SMILES for tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate is CNCCCC(=O)OC.CNCCOCCOCCOCCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate?
The InChIKey is ZGTOOVWMIVEGJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO5.C6H13NO2/c1-14(2,3)20-13(16)5-7-17-9-11-19-12-10-18-8-6-15-4;1-7-5-3-4-6(8)9-2/h15H,5-12H2,1-4H3;7H,3-5H2,1-2H3.
What are the key properties of tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate?
tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate has a molecular weight of 422.56 g/mol, XLogP of 1.15, 16 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]propanoate;methyl 4-(methylamino)butanoate is sourced from PubChem (CID 162115968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).