C21H43NO9 — CID 174777840
tert-butyl 4-[2-[2-[2-[2-[2-[2-(hydroxymethylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]butanoate (PubChem CID 174777840) has the molecular formula C21H43NO9 and a molecular weight of 453.57 g/mol. Its IUPAC name is tert-butyl 4-[2-[2-[2-[2-[2-[2-(hydroxymethylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]butanoate.
| Compound Name | tert-butyl 4-[2-[2-[2-[2-[2-[2-(hydroxymethylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]butanoate |
|---|---|
| PubChem CID | 174777840 |
| Molecular Formula | C21H43NO9 |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | tert-butyl 4-[2-[2-[2-[2-[2-[2-(hydroxymethylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCOCCOCCOCCOCCOCCOCCNCO |
| InChI | InChI=1S/C21H43NO9/c1-21(2,3)31-20(24)5-4-7-25-9-11-27-13-15-29-17-18-30-16-14-28-12-10-26-8-6-22-19-23/h22-23H,4-19H2,1-3H3 |
| InChIKey | SJBFNUZSVKDPJH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|